About 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate
4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate (PubChem CID 165064498) has the molecular formula C18H23BrN2O4
and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate.
Molecular Properties
| Compound Name | 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate |
| PubChem CID | 165064498 |
| Molecular Formula | C18H23BrN2O4 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate |
| SMILES | COC(=O)c1cc(OC)c(N)cc1C.COc1cc(Br)c(C)cc1N |
| InChI | InChI=1S/C10H13NO3.C8H10BrNO/c1-6-4-8(11)9(13-2)5-7(6)10(12)14-3;1-5-3-7(10)8(11-2)4-6(5)9/h4-5H,11H2,1-3H3;3-4H,10H2,1-2H3 |
| InChIKey | RSXWSIKTJCCUPN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate?
The IUPAC name of 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate (CID 165064498) is 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate.
What is the SMILES notation for 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate?
The canonical SMILES for 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate is COC(=O)c1cc(OC)c(N)cc1C.COc1cc(Br)c(C)cc1N.
What is the InChIKey of 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate?
The InChIKey is RSXWSIKTJCCUPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3.C8H10BrNO/c1-6-4-8(11)9(13-2)5-7(6)10(12)14-3;1-5-3-7(10)8(11-2)4-6(5)9/h4-5H,11H2,1-3H3;3-4H,10H2,1-2H3.
What are the key properties of 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate?
4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate has a molecular weight of 411.30 g/mol, XLogP of 3.72, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methoxy-5-methylaniline;methyl 4-amino-5-methoxy-2-methylbenzoate is sourced from PubChem (CID 165064498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).