About 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane
2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane (PubChem CID 165064554) has the molecular formula C23H19NO4S2
and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane.
Molecular Properties
| Compound Name | 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane |
| PubChem CID | 165064554 |
| Molecular Formula | C23H19NO4S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane |
| SMILES | O=C1c2ccccc2C(=O)N1CC[C@H](Oc1cccc2ccoc12)c1cccs1.S |
| InChI | InChI=1S/C23H17NO4S.H2S/c25-22-16-6-1-2-7-17(16)23(26)24(22)12-10-18(20-9-4-14-29-20)28-19-8-3-5-15-11-13-27-21(15)19;/h1-9,11,13-14,18H,10,12H2;1H2/t18-;/m0./s1 |
| InChIKey | RTELIUMWHLQKMB-FERBBOLQSA-N |
| XLogP | 5.41 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane?
The IUPAC name of 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane (CID 165064554) is 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane.
What is the SMILES notation for 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane?
The canonical SMILES for 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane is O=C1c2ccccc2C(=O)N1CC[C@H](Oc1cccc2ccoc12)c1cccs1.S.
What is the InChIKey of 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane?
The InChIKey is RTELIUMWHLQKMB-FERBBOLQSA-N. The full InChI is InChI=1S/C23H17NO4S.H2S/c25-22-16-6-1-2-7-17(16)23(26)24(22)12-10-18(20-9-4-14-29-20)28-19-8-3-5-15-11-13-27-21(15)19;/h1-9,11,13-14,18H,10,12H2;1H2/t18-;/m0./s1.
What are the key properties of 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane?
2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane has a molecular weight of 437.54 g/mol, XLogP of 5.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-(1-benzofuran-7-yloxy)-3-thiophen-2-ylpropyl]isoindole-1,3-dione;sulfane is sourced from PubChem (CID 165064554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).