C18H26O10 — CID 165064958
(4S,5E,6S)-5-ethylidene-4-(2-oxobutyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylic acid (PubChem CID 165064958) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is (4S,5E,6S)-5-ethylidene-4-(2-oxobutyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylic acid.
| Compound Name | (4S,5E,6S)-5-ethylidene-4-(2-oxobutyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 165064958 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (4S,5E,6S)-5-ethylidene-4-(2-oxobutyl)-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylic acid |
| SMILES | C/C=C1/[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)O)[C@H]1CC(=O)CC |
| InChI | InChI=1S/C18H26O10/c1-3-8(20)5-10-9(4-2)17(26-7-11(10)16(24)25)28-18-15(23)14(22)13(21)12(6-19)27-18/h4,7,10,12-15,17-19,21-23H,3,5-6H2,1-2H3,(H,24,25)/b9-4+/t10-,12+,13+,14-,15+,17-,18-/m0/s1 |
| InChIKey | VEQSDFJAUHYUOD-HSRSLQTKSA-N |
| XLogP | -0.94 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|