C17H21NO2 — CID 165065384
2-imino-4-methyl-1-(1-tetracyclo[5.3.1.03,9.05,8]undecanyl)pent-4-ene-1,3-dione (PubChem CID 165065384) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-imino-4-methyl-1-(1-tetracyclo[5.3.1.03,9.05,8]undecanyl)pent-4-ene-1,3-dione.
| Compound Name | 2-imino-4-methyl-1-(1-tetracyclo[5.3.1.03,9.05,8]undecanyl)pent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 165065384 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-imino-4-methyl-1-(1-tetracyclo[5.3.1.03,9.05,8]undecanyl)pent-4-ene-1,3-dione |
| SMILES | [H]/N=C(\C(=O)C(=C)C)C(=O)C12CC3CC4CC(C1)C4C3C2 |
| InChI | InChI=1S/C17H21NO2/c1-8(2)15(19)14(18)16(20)17-5-10-3-9-4-11(6-17)13(9)12(10)7-17/h9-13,18H,1,3-7H2,2H3/b18-14+ |
| InChIKey | RWGHAJYWOSTQNV-NBVRZTHBSA-N |
| XLogP | 2.79 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|