C34H30BrN7O2 — CID 165065632
5-benzyl-12-(4-bromo-3-methylbenzoyl)-11-methyl-7-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one (PubChem CID 165065632) has the molecular formula C34H30BrN7O2 and a molecular weight of 648.57 g/mol. Its IUPAC name is 5-benzyl-12-(4-bromo-3-methylbenzoyl)-11-methyl-7-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one.
| Compound Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-11-methyl-7-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 165065632 |
| Molecular Formula | C34H30BrN7O2 |
| Molecular Weight | 648.57 g/mol |
| Exact Mass | 647.16 |
| IUPAC Name | 5-benzyl-12-(4-bromo-3-methylbenzoyl)-11-methyl-7-[4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-8-one |
| SMILES | Cc1cc(C(=O)N2Cc3c(c(=O)n(-c4ccc(-n5ncnc5C)cc4)c4c(Cc5ccccc5)cnn34)CC2C)ccc1Br |
| InChI | InChI=1S/C34H30BrN7O2/c1-21-15-25(9-14-30(21)35)33(43)39-19-31-29(16-22(39)2)34(44)40(27-10-12-28(13-11-27)41-23(3)36-20-38-41)32-26(18-37-42(31)32)17-24-7-5-4-6-8-24/h4-15,18,20,22H,16-17,19H2,1-3H3 |
| InChIKey | ZXJZFCXPMPRNMD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 90.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |