C17H32O2 — CID 165066222
(1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;trans-(1R,2R)-2-methylcyclohexan-1-ol (PubChem CID 165066222) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;trans-(1R,2R)-2-methylcyclohexan-1-ol.
| Compound Name | (1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;trans-(1R,2R)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 165066222 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (1R,2R,5R)-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol;trans-(1R,2R)-2-methylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@H](O)C1.C[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H18O.C7H14O/c1-7(2)9-5-4-8(3)10(11)6-9;1-6-4-2-3-5-7(6)8/h8-11H,1,4-6H2,2-3H3;6-8H,2-5H2,1H3/t8-,9-,10-;6-,7-/m11/s1 |
| InChIKey | RZVXPUBLLMLDSP-KEOFBJDISA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|