C30H35N5O3 — CID 165066979
(2R)-4-[[5-[(1R)-1-(1,4-dimethylbenzotriazol-5-yl)-3-oxobutyl]-2-methylphenyl]methyl]-2-ethyl-2,3,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one (PubChem CID 165066979) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is (2R)-4-[[5-[(1R)-1-(1,4-dimethylbenzotriazol-5-yl)-3-oxobutyl]-2-methylphenyl]methyl]-2-ethyl-2,3,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one.
| Compound Name | (2R)-4-[[5-[(1R)-1-(1,4-dimethylbenzotriazol-5-yl)-3-oxobutyl]-2-methylphenyl]methyl]-2-ethyl-2,3,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one |
|---|---|
| PubChem CID | 165066979 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (2R)-4-[[5-[(1R)-1-(1,4-dimethylbenzotriazol-5-yl)-3-oxobutyl]-2-methylphenyl]methyl]-2-ethyl-2,3,5,6-tetrahydropyrido[2,3-f][1,4]oxazepin-7-one |
| SMILES | CC[C@@H]1CN(Cc2cc([C@@H](CC(C)=O)c3ccc4c(nnn4C)c3C)ccc2C)Cc2[nH]c(=O)ccc2O1 |
| InChI | InChI=1S/C30H35N5O3/c1-6-23-16-35(17-26-28(38-23)11-12-29(37)31-26)15-22-14-21(8-7-18(22)2)25(13-19(3)36)24-9-10-27-30(20(24)4)32-33-34(27)5/h7-12,14,23,25H,6,13,15-17H2,1-5H3,(H,31,37)/t23-,25-/m1/s1 |
| InChIKey | SDACNGAKPRNEOR-ILBGXUMGSA-N |
| XLogP | 4.56 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |