C29H50O3 — CID 165067234
(4aS,8aS)-8a-hydroxy-4a,7,7-trimethyl-1,3,4,5,6,8-hexahydronaphthalen-2-one;(3R,4aR,8aR)-6,6,8a-trimethyl-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalen-4a-ol (PubChem CID 165067234) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is (4aS,8aS)-8a-hydroxy-4a,7,7-trimethyl-1,3,4,5,6,8-hexahydronaphthalen-2-one;(3R,4aR,8aR)-6,6,8a-trimethyl-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aS,8aS)-8a-hydroxy-4a,7,7-trimethyl-1,3,4,5,6,8-hexahydronaphthalen-2-one;(3R,4aR,8aR)-6,6,8a-trimethyl-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 165067234 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | (4aS,8aS)-8a-hydroxy-4a,7,7-trimethyl-1,3,4,5,6,8-hexahydronaphthalen-2-one;(3R,4aR,8aR)-6,6,8a-trimethyl-3-prop-1-en-2-yl-2,3,4,5,7,8-hexahydro-1H-naphthalen-4a-ol |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)CCC(C)(C)C[C@]2(O)C1.CC1(C)CC[C@@]2(C)CCC(=O)C[C@@]2(O)C1 |
| InChI | InChI=1S/C16H28O.C13H22O2/c1-12(2)13-6-7-15(5)9-8-14(3,4)11-16(15,17)10-13;1-11(2)6-7-12(3)5-4-10(14)8-13(12,15)9-11/h13,17H,1,6-11H2,2-5H3;15H,4-9H2,1-3H3/t13-,15-,16-;12-,13-/m11/s1 |
| InChIKey | SEBUTJPYTKCFHX-REAPHQPISA-N |
| XLogP | 7.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|