C23H23N7O3 — CID 165067721
(11R)-18-ethyl-11-methyl-5-pyridin-2-yl-9-oxa-2,5,12,16,17,20-hexazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),6,14(21),15,18-hexaene-4,13-dione (PubChem CID 165067721) has the molecular formula C23H23N7O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is (11R)-18-ethyl-11-methyl-5-pyridin-2-yl-9-oxa-2,5,12,16,17,20-hexazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),6,14(21),15,18-hexaene-4,13-dione.
| Compound Name | (11R)-18-ethyl-11-methyl-5-pyridin-2-yl-9-oxa-2,5,12,16,17,20-hexazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),6,14(21),15,18-hexaene-4,13-dione |
|---|---|
| PubChem CID | 165067721 |
| Molecular Formula | C23H23N7O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (11R)-18-ethyl-11-methyl-5-pyridin-2-yl-9-oxa-2,5,12,16,17,20-hexazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3(22),6,14(21),15,18-hexaene-4,13-dione |
| SMILES | CCc1cc2nc3c(cnn13)C(=O)N[C@H](C)COCc1cc(c(=O)n(-c3ccccn3)c1)N2 |
| InChI | InChI=1S/C23H23N7O3/c1-3-16-9-19-27-18-8-15(11-29(23(18)32)20-6-4-5-7-24-20)13-33-12-14(2)26-22(31)17-10-25-30(16)21(17)28-19/h4-11,14H,3,12-13H2,1-2H3,(H,26,31)(H,27,28)/t14-/m1/s1 |
| InChIKey | IRLFUEKAMCISIB-CQSZACIVSA-N |
| XLogP | 2.23 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |