C23H22N2O4 — CID 165068019
1-[5-[(E)-4-hydroxy-3-oxobut-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 165068019) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[5-[(E)-4-hydroxy-3-oxobut-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 1-[5-[(E)-4-hydroxy-3-oxobut-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 165068019 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[5-[(E)-4-hydroxy-3-oxobut-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)CN(C3CCc4cc(/C=C/C(=O)CO)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-15-2-7-18(8-3-15)25-22(28)13-24(23(25)29)21-11-6-17-12-16(5-10-20(17)21)4-9-19(27)14-26/h2-5,7-10,12,21,26H,6,11,13-14H2,1H3/b9-4+ |
| InChIKey | SHCNIQHJAGQLRD-RUDMXATFSA-N |
| XLogP | 3.03 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|