C63H42N4S — CID 165071133
7-[4-[2,4-bis(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]-2,6-diphenylphenyl]-[1]benzothiolo[2,3-b]carbazole (PubChem CID 165071133) has the molecular formula C63H42N4S and a molecular weight of 887.12 g/mol. Its IUPAC name is 7-[4-[2,4-bis(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]-2,6-diphenylphenyl]-[1]benzothiolo[2,3-b]carbazole.
| Compound Name | 7-[4-[2,4-bis(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]-2,6-diphenylphenyl]-[1]benzothiolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 165071133 |
| Molecular Formula | C63H42N4S |
| Molecular Weight | 887.12 g/mol |
| Exact Mass | 886.31 |
| IUPAC Name | 7-[4-[2,4-bis(4-phenylphenyl)-1,2-dihydro-1,3,5-triazin-6-yl]-2,6-diphenylphenyl]-[1]benzothiolo[2,3-b]carbazole |
| SMILES | c1ccc(-c2ccc(C3=NC(c4ccc(-c5ccccc5)cc4)NC(c4cc(-c5ccccc5)c(-n5c6ccccc6c6cc7c(cc65)sc5ccccc57)c(-c5ccccc5)c4)=N3)cc2)cc1 |
| InChI | InChI=1S/C63H42N4S/c1-5-17-41(18-6-1)43-29-33-47(34-30-43)61-64-62(48-35-31-44(32-36-48)42-19-7-2-8-20-42)66-63(65-61)49-37-52(45-21-9-3-10-22-45)60(53(38-49)46-23-11-4-12-24-46)67-56-27-15-13-25-50(56)54-39-55-51-26-14-16-28-58(51)68-59(55)40-57(54)67/h1-40,61H,(H,64,65,66) |
| InChIKey | WMFYZWCZFVHLMK-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.12 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |