C32H44O8 — CID 165072117
(3aR,4S,6S,7S,7aR)-7-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran (PubChem CID 165072117) has the molecular formula C32H44O8 and a molecular weight of 556.70 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aR)-7-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran.
| Compound Name | (3aR,4S,6S,7S,7aR)-7-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
|---|---|
| PubChem CID | 165072117 |
| Molecular Formula | C32H44O8 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | (3aR,4S,6S,7S,7aR)-7-[(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxy-4-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran |
| SMILES | CC[C@H]1OC(O[C@@H]2[C@H]3OC(C)(C)O[C@H]3[C@@H](OC)O[C@H]2C)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C32H44O8/c1-7-24-20(2)25(34-18-22-14-10-8-11-15-22)28(35-19-23-16-12-9-13-17-23)31(37-24)38-26-21(3)36-30(33-6)29-27(26)39-32(4,5)40-29/h8-17,20-21,24-31H,7,18-19H2,1-6H3/t20-,21+,24-,25+,26+,27-,28-,29-,30+,31?/m1/s1 |
| InChIKey | CJYOHFBNSNKYJM-NOFAYEKXSA-N |
| XLogP | 5.22 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |