About ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one
ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one (PubChem CID 165072128) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one.
Molecular Properties
| Compound Name | ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one |
| PubChem CID | 165072128 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one |
| SMILES | CC.CNCc1oc(=O)oc1C |
| InChI | InChI=1S/C6H9NO3.C2H6/c1-4-5(3-7-2)10-6(8)9-4;1-2/h7H,3H2,1-2H3;1-2H3 |
| InChIKey | SYCYAFUXNYLMSS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one?
The IUPAC name of ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one (CID 165072128) is ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one.
What is the SMILES notation for ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one?
The canonical SMILES for ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one is CC.CNCc1oc(=O)oc1C.
What is the InChIKey of ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one?
The InChIKey is SYCYAFUXNYLMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.C2H6/c1-4-5(3-7-2)10-6(8)9-4;1-2/h7H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one?
ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one has a molecular weight of 173.21 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-5-(methylaminomethyl)-1,3-dioxol-2-one is sourced from PubChem (CID 165072128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).