About 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide
4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide (PubChem CID 165072516) has the molecular formula C10H10F3NO5S2
and a molecular weight of 345.32 g/mol. Its IUPAC name is 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide |
| PubChem CID | 165072516 |
| Molecular Formula | C10H10F3NO5S2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)NS(=O)(=O)c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C10H10F3NO5S2/c11-10(12,13)6-20(15,16)14-21(17,18)8-3-1-7(2-4-8)9-5-19-9/h1-4,9,14H,5-6H2 |
| InChIKey | IBFLHBUTALKVBI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide?
The IUPAC name of 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide (CID 165072516) is 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide.
What is the SMILES notation for 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide?
The canonical SMILES for 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide is O=S(=O)(CC(F)(F)F)NS(=O)(=O)c1ccc(C2CO2)cc1.
What is the InChIKey of 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide?
The InChIKey is IBFLHBUTALKVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO5S2/c11-10(12,13)6-20(15,16)14-21(17,18)8-3-1-7(2-4-8)9-5-19-9/h1-4,9,14H,5-6H2.
What are the key properties of 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide?
4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide has a molecular weight of 345.32 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxiran-2-yl)-N-(2,2,2-trifluoroethylsulfonyl)benzenesulfonamide is sourced from PubChem (CID 165072516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).