C14H20AuN3PS+ — CID 165073434
gold(1+);3-methylbenzene-2-ide-1-carbothialdehyde;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane (PubChem CID 165073434) has the molecular formula C14H20AuN3PS+ and a molecular weight of 490.34 g/mol. Its IUPAC name is gold(1+);3-methylbenzene-2-ide-1-carbothialdehyde;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane.
| Compound Name | gold(1+);3-methylbenzene-2-ide-1-carbothialdehyde;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 165073434 |
| Molecular Formula | C14H20AuN3PS+ |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | gold(1+);3-methylbenzene-2-ide-1-carbothialdehyde;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
| SMILES | C1N2CN3CN1C[PH+](C2)C3.Cc1[c-]c(C=S)ccc1.[Au+] |
| InChI | InChI=1S/C8H7S.C6H12N3P.Au/c1-7-3-2-4-8(5-7)6-9;1-7-2-9-3-8(1)5-10(4-7)6-9;/h2-4,6H,1H3;1-6H2;/q-1;;+1/p+1 |
| InChIKey | WBYDNRYMRWAMKR-UHFFFAOYSA-O |
| XLogP | 2.03 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|