About 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine
6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine (PubChem CID 165075826) has the molecular formula C19H25N7O
and a molecular weight of 367.46 g/mol. Its IUPAC name is 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine |
| PubChem CID | 165075826 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine |
| SMILES | CC(C)(C)c1ncnc2ocnc12.Cn1cnc2ncnc(C(C)(C)C)c21 |
| InChI | InChI=1S/C10H14N4.C9H11N3O/c1-10(2,3)8-7-9(12-5-11-8)13-6-14(7)4;1-9(2,3)7-6-8(11-4-10-7)13-5-12-6/h5-6H,1-4H3;4-5H,1-3H3 |
| InChIKey | UHBXVWFAHHIUPS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine?
The IUPAC name of 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine (CID 165075826) is 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine.
What is the SMILES notation for 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine?
The canonical SMILES for 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine is CC(C)(C)c1ncnc2ocnc12.Cn1cnc2ncnc(C(C)(C)C)c21.
What is the InChIKey of 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine?
The InChIKey is UHBXVWFAHHIUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4.C9H11N3O/c1-10(2,3)8-7-9(12-5-11-8)13-6-14(7)4;1-9(2,3)7-6-8(11-4-10-7)13-5-12-6/h5-6H,1-4H3;4-5H,1-3H3.
What are the key properties of 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine?
6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine has a molecular weight of 367.46 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-7-methylpurine;7-tert-butyl-[1,3]oxazolo[5,4-d]pyrimidine is sourced from PubChem (CID 165075826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).