C20H27F2N5O2 — CID 165075942
4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]cyclohexane-1,3-dione (PubChem CID 165075942) has the molecular formula C20H27F2N5O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]cyclohexane-1,3-dione.
| Compound Name | 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 165075942 |
| Molecular Formula | C20H27F2N5O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 4-[[5-[4-(3,3-difluoropiperidin-4-yl)piperazin-1-yl]-2-pyridinyl]amino]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(Nc2ccc(N3CCN(C4CCNCC4(F)F)CC3)cn2)C(=O)C1 |
| InChI | InChI=1S/C20H27F2N5O2/c21-20(22)13-23-6-5-18(20)27-9-7-26(8-10-27)14-1-4-19(24-12-14)25-16-3-2-15(28)11-17(16)29/h1,4,12,16,18,23H,2-3,5-11,13H2,(H,24,25) |
| InChIKey | VOBYYFFYHBXYIR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|