About 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol
2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol (PubChem CID 165076036) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol |
| PubChem CID | 165076036 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol |
| SMILES | OCCNCc1cnc(OCc2ccccc2)s1 |
| InChI | InChI=1S/C13H16N2O2S/c16-7-6-14-8-12-9-15-13(18-12)17-10-11-4-2-1-3-5-11/h1-5,9,14,16H,6-8,10H2 |
| InChIKey | UHYDAKZKTHMYFU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol?
The IUPAC name of 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol (CID 165076036) is 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol.
What is the SMILES notation for 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol?
The canonical SMILES for 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol is OCCNCc1cnc(OCc2ccccc2)s1.
What is the InChIKey of 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol?
The InChIKey is UHYDAKZKTHMYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c16-7-6-14-8-12-9-15-13(18-12)17-10-11-4-2-1-3-5-11/h1-5,9,14,16H,6-8,10H2.
What are the key properties of 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol?
2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol has a molecular weight of 264.35 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-phenylmethoxy-1,3-thiazol-5-yl)methylamino]ethanol is sourced from PubChem (CID 165076036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).