C25H42N8O3 — CID 165076932
2,5-diethyl-1,3,4-oxadiazole;3,5-diethyl-1,2,4-oxadiazole;3,5-diethyl-1,2-oxazole;1,4-diethyltriazole (PubChem CID 165076932) has the molecular formula C25H42N8O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is 2,5-diethyl-1,3,4-oxadiazole;3,5-diethyl-1,2,4-oxadiazole;3,5-diethyl-1,2-oxazole;1,4-diethyltriazole.
| Compound Name | 2,5-diethyl-1,3,4-oxadiazole;3,5-diethyl-1,2,4-oxadiazole;3,5-diethyl-1,2-oxazole;1,4-diethyltriazole |
|---|---|
| PubChem CID | 165076932 |
| Molecular Formula | C25H42N8O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 2,5-diethyl-1,3,4-oxadiazole;3,5-diethyl-1,2,4-oxadiazole;3,5-diethyl-1,2-oxazole;1,4-diethyltriazole |
| SMILES | CCc1cc(CC)on1.CCc1cn(CC)nn1.CCc1nnc(CC)o1.CCc1noc(CC)n1 |
| InChI | InChI=1S/C7H11NO.C6H11N3.2C6H10N2O/c1-3-6-5-7(4-2)9-8-6;1-3-6-5-9(4-2)8-7-6;1-3-5-7-8-6(4-2)9-5;1-3-5-7-6(4-2)9-8-5/h2*5H,3-4H2,1-2H3;2*3-4H2,1-2H3 |
| InChIKey | ULRIQZOWMRCAPG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 134.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |