About CID 165077448
CID 165077448 (PubChem CID 165077448) has the molecular formula C56H34F4N4O2S2
and a molecular weight of 935.04 g/mol.
Molecular Properties
| Compound Name | CID 165077448 |
| PubChem CID | 165077448 |
| Molecular Formula | C56H34F4N4O2S2 |
| Molecular Weight | 935.04 g/mol |
| Exact Mass | 934.21 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]C(C#N)=C1/C(=C/c2cc3c(s2)C2=CC4C=C5C(=CC4C=C2C32CCCCC2)c2sc(/C=C3\C(=O)c4cc(F)c(F)cc4\C3=C(\C#N)[N+]#[C-])cc2C52CCCCC2)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C56H34F4N4O2S2/c1-63-47(25-61)49-31-21-43(57)45(59)23-33(31)51(65)37(49)17-29-19-41-53(67-29)35-13-27-16-40-36(14-28(27)15-39(35)55(41)9-5-3-6-10-55)54-42(56(40)11-7-4-8-12-56)20-30(68-54)18-38-50(48(26-62)64-2)32-22-44(58)46(60)24-34(32)52(38)66/h13-24,27-28H,3-12H2/b37-17-,38-18-,49-47+,50-48? |
| InChIKey | LQSDBHGXLIJSTG-BJUJARKSSA-N |
| XLogP | 14.24 |
| TPSA | 90.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 935.04 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 165077448 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165077448?
The IUPAC name of CID 165077448 (CID 165077448) is not available.
What is the SMILES notation for CID 165077448?
The canonical SMILES for CID 165077448 is [C-]#[N+]C(C#N)=C1/C(=C/c2cc3c(s2)C2=CC4C=C5C(=CC4C=C2C32CCCCC2)c2sc(/C=C3\C(=O)c4cc(F)c(F)cc4\C3=C(\C#N)[N+]#[C-])cc2C52CCCCC2)C(=O)c2cc(F)c(F)cc21.
What is the InChIKey of CID 165077448?
The InChIKey is LQSDBHGXLIJSTG-BJUJARKSSA-N. The full InChI is InChI=1S/C56H34F4N4O2S2/c1-63-47(25-61)49-31-21-43(57)45(59)23-33(31)51(65)37(49)17-29-19-41-53(67-29)35-13-27-16-40-36(14-28(27)15-39(35)55(41)9-5-3-6-10-55)54-42(56(40)11-7-4-8-12-56)20-30(68-54)18-38-50(48(26-62)64-2)32-22-44(58)46(60)24-34(32)52(38)66/h13-24,27-28H,3-12H2/b37-17-,38-18-,49-47+,50-48?.
What are the key properties of CID 165077448?
CID 165077448 has a molecular weight of 935.04 g/mol, XLogP of 14.24, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165077448 is sourced from PubChem (CID 165077448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).