About 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate
2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 165077544) has the molecular formula C14H22O5S
and a molecular weight of 302.39 g/mol. Its IUPAC name is 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 165077544 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | COS(=O)(=O)CCOC(=O)C1C=CC(C(C)(C)C)=CC1 |
| InChI | InChI=1S/C14H22O5S/c1-14(2,3)12-7-5-11(6-8-12)13(15)19-9-10-20(16,17)18-4/h5,7-8,11H,6,9-10H2,1-4H3 |
| InChIKey | UOJRVMLLMBIMNH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate (CID 165077544) is 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate is COS(=O)(=O)CCOC(=O)C1C=CC(C(C)(C)C)=CC1.
What is the InChIKey of 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate?
The InChIKey is UOJRVMLLMBIMNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5S/c1-14(2,3)12-7-5-11(6-8-12)13(15)19-9-10-20(16,17)18-4/h5,7-8,11H,6,9-10H2,1-4H3.
What are the key properties of 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate?
2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate has a molecular weight of 302.39 g/mol, XLogP of 2.05, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysulfonylethyl 4-tert-butylcyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 165077544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).