C35H40BBr2N3O5 — CID 165079889
4-bromo-3-methoxyaniline;6-bromo-7-methoxy-2-methylquinoline;7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 165079889) has the molecular formula C35H40BBr2N3O5 and a molecular weight of 753.34 g/mol. Its IUPAC name is 4-bromo-3-methoxyaniline;6-bromo-7-methoxy-2-methylquinoline;7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 4-bromo-3-methoxyaniline;6-bromo-7-methoxy-2-methylquinoline;7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 165079889 |
| Molecular Formula | C35H40BBr2N3O5 |
| Molecular Weight | 753.34 g/mol |
| Exact Mass | 751.14 |
| IUPAC Name | 4-bromo-3-methoxyaniline;6-bromo-7-methoxy-2-methylquinoline;7-methoxy-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | COc1cc(N)ccc1Br.COc1cc2nc(C)ccc2cc1B1OC(C)(C)C(C)(C)O1.COc1cc2nc(C)ccc2cc1Br |
| InChI | InChI=1S/C17H22BNO3.C11H10BrNO.C7H8BrNO/c1-11-7-8-12-9-13(15(20-6)10-14(12)19-11)18-21-16(2,3)17(4,5)22-18;1-7-3-4-8-5-9(12)11(14-2)6-10(8)13-7;1-10-7-4-5(9)2-3-6(7)8/h7-10H,1-6H3;3-6H,1-2H3;2-4H,9H2,1H3 |
| InChIKey | UYEXBUPLGUNTHP-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.34 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|