C6H12O — CID 16508
(2R,5S)-2,5-dimethyloxolane (PubChem CID 16508) has the molecular formula C6H12O and a molecular weight of 100.16 g/mol. Its IUPAC name is (2R,5S)-2,5-dimethyloxolane.
| Compound Name | (2R,5S)-2,5-dimethyloxolane |
|---|---|
| PubChem CID | 16508 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | (2R,5S)-2,5-dimethyloxolane |
| SMILES | C[C@@H]1CC[C@H](C)O1 |
| InChI | InChI=1S/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | OXMIDRBAFOEOQT-OLQVQODUSA-N |
| XLogP | 1.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |