About 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane)
2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) (PubChem CID 165080148) has the molecular formula C21H41N3
and a molecular weight of 335.58 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane).
Molecular Properties
| Compound Name | 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) |
| PubChem CID | 165080148 |
| Molecular Formula | C21H41N3 |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.33 |
| IUPAC Name | 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) |
| SMILES | C.CC(C)C.CC(C)C.CC(C)c1cn2nc(C(C)C)ccc2n1 |
| InChI | InChI=1S/C12H17N3.2C4H10.CH4/c1-8(2)10-5-6-12-13-11(9(3)4)7-15(12)14-10;2*1-4(2)3;/h5-9H,1-4H3;2*4H,1-3H3;1H4 |
| InChIKey | UZDFFQYABBJJPR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane)?
The IUPAC name of 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) (CID 165080148) is 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane).
What is the SMILES notation for 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane)?
The canonical SMILES for 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) is C.CC(C)C.CC(C)C.CC(C)c1cn2nc(C(C)C)ccc2n1.
What is the InChIKey of 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane)?
The InChIKey is UZDFFQYABBJJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3.2C4H10.CH4/c1-8(2)10-5-6-12-13-11(9(3)4)7-15(12)14-10;2*1-4(2)3;/h5-9H,1-4H3;2*4H,1-3H3;1H4.
What are the key properties of 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane)?
2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) has a molecular weight of 335.58 g/mol, XLogP of 6.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(propan-2-yl)imidazo[1,2-b]pyridazine;methane;bis(2-methylpropane) is sourced from PubChem (CID 165080148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).