C20H20Br2ClN3 — CID 165081411
1-azido-6-bromo-1,2,3,4-tetrahydronaphthalene;6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene (PubChem CID 165081411) has the molecular formula C20H20Br2ClN3 and a molecular weight of 497.66 g/mol. Its IUPAC name is 1-azido-6-bromo-1,2,3,4-tetrahydronaphthalene;6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-azido-6-bromo-1,2,3,4-tetrahydronaphthalene;6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 165081411 |
| Molecular Formula | C20H20Br2ClN3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | 1-azido-6-bromo-1,2,3,4-tetrahydronaphthalene;6-bromo-1-chloro-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClC1CCCc2cc(Br)ccc21.[N-]=[N+]=NC1CCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H10BrCl.C10H10BrN3/c11-8-4-5-9-7(6-8)2-1-3-10(9)12;11-8-4-5-9-7(6-8)2-1-3-10(9)13-14-12/h4-6,10H,1-3H2;4-6,10H,1-3H2 |
| InChIKey | VEMTZGFGUYXCLG-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|