C17H17N5O3 — CID 16508187
N-(3,5-dimethoxyphenyl)-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 16508187) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16508187 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | COc1cc(NC(=O)Cn2nnc(-c3ccccc3)n2)cc(OC)c1 |
| InChI | InChI=1S/C17H17N5O3/c1-24-14-8-13(9-15(10-14)25-2)18-16(23)11-22-20-17(19-21-22)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3,(H,18,23) |
| InChIKey | VNYICVZFKPUWGK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |