C29H27ClFN3O3 — CID 165082533
2-[[5-(2-aminoethynyl)-2-pyridinyl]methyl]-3-(4-chlorophenyl)-6-[cyclohexyl(hydroxy)methyl]-4-fluoro-3-hydroxyisoindol-1-one (PubChem CID 165082533) has the molecular formula C29H27ClFN3O3 and a molecular weight of 520.00 g/mol. Its IUPAC name is 2-[[5-(2-aminoethynyl)-2-pyridinyl]methyl]-3-(4-chlorophenyl)-6-[cyclohexyl(hydroxy)methyl]-4-fluoro-3-hydroxyisoindol-1-one.
| Compound Name | 2-[[5-(2-aminoethynyl)-2-pyridinyl]methyl]-3-(4-chlorophenyl)-6-[cyclohexyl(hydroxy)methyl]-4-fluoro-3-hydroxyisoindol-1-one |
|---|---|
| PubChem CID | 165082533 |
| Molecular Formula | C29H27ClFN3O3 |
| Molecular Weight | 520.00 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-[[5-(2-aminoethynyl)-2-pyridinyl]methyl]-3-(4-chlorophenyl)-6-[cyclohexyl(hydroxy)methyl]-4-fluoro-3-hydroxyisoindol-1-one |
| SMILES | NC#Cc1ccc(CN2C(=O)c3cc(C(O)C4CCCCC4)cc(F)c3C2(O)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C29H27ClFN3O3/c30-22-9-7-21(8-10-22)29(37)26-24(14-20(15-25(26)31)27(35)19-4-2-1-3-5-19)28(36)34(29)17-23-11-6-18(12-13-32)16-33-23/h6-11,14-16,19,27,35,37H,1-5,17,32H2 |
| InChIKey | KLLKWRUZUFBVEJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|