C28H46N2O2 — CID 165082708
4-methyl-6-(2,4,4-trimethylpentyl)-1H-pyridin-2-one (PubChem CID 165082708) has the molecular formula C28H46N2O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is 4-methyl-6-(2,4,4-trimethylpentyl)-1H-pyridin-2-one.
| Compound Name | 4-methyl-6-(2,4,4-trimethylpentyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 165082708 |
| Molecular Formula | C28H46N2O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | 4-methyl-6-(2,4,4-trimethylpentyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)[nH]c(=O)c1.Cc1cc(CC(C)CC(C)(C)C)[nH]c(=O)c1 |
| InChI | InChI=1S/2C14H23NO/c2*1-10-6-12(15-13(16)8-10)7-11(2)9-14(3,4)5/h2*6,8,11H,7,9H2,1-5H3,(H,15,16) |
| InChIKey | VJOPXBHYSSRBLC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |