C25H26N4O7 — CID 165082956
1-[(4-aminophenyl)methyl]pyrrole-2-carboxylic acid;methanol;1-[(4-nitrophenyl)methyl]pyrrole-2-carboxylic acid (PubChem CID 165082956) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]pyrrole-2-carboxylic acid;methanol;1-[(4-nitrophenyl)methyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[(4-aminophenyl)methyl]pyrrole-2-carboxylic acid;methanol;1-[(4-nitrophenyl)methyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 165082956 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]pyrrole-2-carboxylic acid;methanol;1-[(4-nitrophenyl)methyl]pyrrole-2-carboxylic acid |
| SMILES | CO.Nc1ccc(Cn2cccc2C(=O)O)cc1.O=C(O)c1cccn1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N2O4.C12H12N2O2.CH4O/c15-12(16)11-2-1-7-13(11)8-9-3-5-10(6-4-9)14(17)18;13-10-5-3-9(4-6-10)8-14-7-1-2-11(14)12(15)16;1-2/h1-7H,8H2,(H,15,16);1-7H,8,13H2,(H,15,16);2H,1H3 |
| InChIKey | VKQYEZYTZZMZNI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 173.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|