C8H13NO2 — CID 165083138
(4aS,8aR)-1,4,4a,5,6,7,8,8a-octahydropyrano[4,3-c]pyridin-3-one (PubChem CID 165083138) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (4aS,8aR)-1,4,4a,5,6,7,8,8a-octahydropyrano[4,3-c]pyridin-3-one.
| Compound Name | (4aS,8aR)-1,4,4a,5,6,7,8,8a-octahydropyrano[4,3-c]pyridin-3-one |
|---|---|
| PubChem CID | 165083138 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (4aS,8aR)-1,4,4a,5,6,7,8,8a-octahydropyrano[4,3-c]pyridin-3-one |
| SMILES | O=C1C[C@@H]2CNCC[C@H]2CO1 |
| InChI | InChI=1S/C8H13NO2/c10-8-3-7-4-9-2-1-6(7)5-11-8/h6-7,9H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | JXNCOAABDKVWJP-NKWVEPMBSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |