C19H14ClFN4OS — CID 16508348
1-[(2-chloro-4-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 16508348) has the molecular formula C19H14ClFN4OS and a molecular weight of 400.87 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 16508348 |
| Molecular Formula | C19H14ClFN4OS |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methylsulfanyl]-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCc3ccc(F)cc3Cl)nnc12 |
| InChI | InChI=1S/C19H14ClFN4OS/c1-2-9-24-17(26)14-5-3-4-6-16(14)25-18(24)22-23-19(25)27-11-12-7-8-13(21)10-15(12)20/h2-8,10H,1,9,11H2 |
| InChIKey | DYDWEQSJEWKDKO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|