C17H28F6N2O4 — CID 165084614
(2S)-N-[(3S)-6-amino-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-hydroxyhexan-3-yl]-4-oxo-2-propan-2-ylpentanamide (PubChem CID 165084614) has the molecular formula C17H28F6N2O4 and a molecular weight of 438.41 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-amino-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-hydroxyhexan-3-yl]-4-oxo-2-propan-2-ylpentanamide.
| Compound Name | (2S)-N-[(3S)-6-amino-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-hydroxyhexan-3-yl]-4-oxo-2-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 165084614 |
| Molecular Formula | C17H28F6N2O4 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2S)-N-[(3S)-6-amino-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-hydroxyhexan-3-yl]-4-oxo-2-propan-2-ylpentanamide |
| SMILES | CC(=O)C[C@H](C(=O)N[C@@H](CCCN)C(O)COC(C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C17H28F6N2O4/c1-9(2)11(7-10(3)26)14(28)25-12(5-4-6-24)13(27)8-29-15(16(18,19)20)17(21,22)23/h9,11-13,15,27H,4-8,24H2,1-3H3,(H,25,28)/t11-,12-,13?/m0/s1 |
| InChIKey | FNCQEIGGIHYUES-VYAYZGMFSA-N |
| XLogP | 2.33 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |