C21H25N5OS — CID 16508705
N-(4-tert-butylphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 16508705) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 16508705 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[1-(2-methylphenyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | Cc1ccccc1-n1nnnc1SC(C)C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H25N5OS/c1-14-8-6-7-9-18(14)26-20(23-24-25-26)28-15(2)19(27)22-17-12-10-16(11-13-17)21(3,4)5/h6-13,15H,1-5H3,(H,22,27) |
| InChIKey | WVERFJTZFGQHHJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |