C15H9F5N4S — CID 16508779
1-(2-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]tetrazole (PubChem CID 16508779) has the molecular formula C15H9F5N4S and a molecular weight of 372.32 g/mol. Its IUPAC name is 1-(2-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]tetrazole.
| Compound Name | 1-(2-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 16508779 |
| Molecular Formula | C15H9F5N4S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-(2-methylphenyl)-5-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]tetrazole |
| SMILES | Cc1ccccc1-n1nnnc1SCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H9F5N4S/c1-7-4-2-3-5-9(7)24-15(21-22-23-24)25-6-8-10(16)12(18)14(20)13(19)11(8)17/h2-5H,6H2,1H3 |
| InChIKey | GIZZDKOSSTYJCG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|