About CID 165088007
CID 165088007 (PubChem CID 165088007) has the molecular formula C8H6FKNO
and a molecular weight of 190.24 g/mol.
Molecular Properties
| Compound Name | CID 165088007 |
| PubChem CID | 165088007 |
| Molecular Formula | C8H6FKNO |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | — |
| SMILES | O=C1Cc2ccccc2N1F.[K] |
| InChI | InChI=1S/C8H6FNO.K/c9-10-7-4-2-1-3-6(7)5-8(10)11;/h1-4H,5H2; |
| InChIKey | WFKIPCQQBGLPQC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 165088007 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165088007?
The IUPAC name of CID 165088007 (CID 165088007) is not available.
What is the SMILES notation for CID 165088007?
The canonical SMILES for CID 165088007 is O=C1Cc2ccccc2N1F.[K].
What is the InChIKey of CID 165088007?
The InChIKey is WFKIPCQQBGLPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO.K/c9-10-7-4-2-1-3-6(7)5-8(10)11;/h1-4H,5H2;.
What are the key properties of CID 165088007?
CID 165088007 has a molecular weight of 190.24 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165088007 is sourced from PubChem (CID 165088007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).