C25H35N3OS — CID 165088203
[[(3R,4S)-3-methyl-3-[(4-phenylcyclohexyl)oxymethyl]-1-pyridin-2-ylpiperidin-4-yl]amino]methanethiol (PubChem CID 165088203) has the molecular formula C25H35N3OS and a molecular weight of 425.64 g/mol. Its IUPAC name is [[(3R,4S)-3-methyl-3-[(4-phenylcyclohexyl)oxymethyl]-1-pyridin-2-ylpiperidin-4-yl]amino]methanethiol.
| Compound Name | [[(3R,4S)-3-methyl-3-[(4-phenylcyclohexyl)oxymethyl]-1-pyridin-2-ylpiperidin-4-yl]amino]methanethiol |
|---|---|
| PubChem CID | 165088203 |
| Molecular Formula | C25H35N3OS |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | [[(3R,4S)-3-methyl-3-[(4-phenylcyclohexyl)oxymethyl]-1-pyridin-2-ylpiperidin-4-yl]amino]methanethiol |
| SMILES | C[C@@]1(COC2CCC(c3ccccc3)CC2)CN(c2ccccn2)CC[C@@H]1NCS |
| InChI | InChI=1S/C25H35N3OS/c1-25(17-28(16-14-23(25)27-19-30)24-9-5-6-15-26-24)18-29-22-12-10-21(11-13-22)20-7-3-2-4-8-20/h2-9,15,21-23,27,30H,10-14,16-19H2,1H3/t21?,22?,23-,25-/m0/s1 |
| InChIKey | WGENWSVLAXIEOI-BKKSKEKOSA-N |
| XLogP | 4.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|