C44H34S3Si — CID 165089081
trimethyl-[4-[4-[16-[4-(4-methylphenyl)phenyl]-7,11,15-trithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaen-6-yl]phenyl]phenyl]silane (PubChem CID 165089081) has the molecular formula C44H34S3Si and a molecular weight of 687.04 g/mol. Its IUPAC name is trimethyl-[4-[4-[16-[4-(4-methylphenyl)phenyl]-7,11,15-trithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaen-6-yl]phenyl]phenyl]silane.
| Compound Name | trimethyl-[4-[4-[16-[4-(4-methylphenyl)phenyl]-7,11,15-trithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaen-6-yl]phenyl]phenyl]silane |
|---|---|
| PubChem CID | 165089081 |
| Molecular Formula | C44H34S3Si |
| Molecular Weight | 687.04 g/mol |
| Exact Mass | 686.16 |
| IUPAC Name | trimethyl-[4-[4-[16-[4-(4-methylphenyl)phenyl]-7,11,15-trithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,5,8,13,16,18-octaen-6-yl]phenyl]phenyl]silane |
| SMILES | Cc1ccc(-c2ccc(-c3cc4cc5c(cc4s3)sc3cc4sc(-c6ccc(-c7ccc([Si](C)(C)C)cc7)cc6)cc4cc35)cc2)cc1 |
| InChI | InChI=1S/C44H34S3Si/c1-27-5-7-28(8-6-27)29-9-13-32(14-10-29)39-23-34-21-37-38-22-35-24-40(46-42(35)26-44(38)47-43(37)25-41(34)45-39)33-15-11-30(12-16-33)31-17-19-36(20-18-31)48(2,3)4/h5-26H,1-4H3 |
| InChIKey | FBRQVNSCNMFRMY-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.04 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|