C12H22O5 — CID 165089121
(3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enal (PubChem CID 165089121) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enal.
| Compound Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enal |
|---|---|
| PubChem CID | 165089121 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enal |
| SMILES | C=C[C@@H](OCOC)[C@H](C)[C@@H](CC=O)OCOC |
| InChI | InChI=1S/C12H22O5/c1-5-11(16-8-14-3)10(2)12(6-7-13)17-9-15-4/h5,7,10-12H,1,6,8-9H2,2-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | KWPMQSWLHARSIG-QJPTWQEYSA-N |
| XLogP | 1.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|