C14H22NOPSi — CID 165089497
[(3S,3aS)-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-dimethyl-phenylsilane (PubChem CID 165089497) has the molecular formula C14H22NOPSi and a molecular weight of 279.40 g/mol. Its IUPAC name is [(3S,3aS)-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-dimethyl-phenylsilane.
| Compound Name | [(3S,3aS)-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 165089497 |
| Molecular Formula | C14H22NOPSi |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | [(3S,3aS)-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-3-yl]methyl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(C[C@H]1OPN2CCC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C14H22NOPSi/c1-18(2,12-7-4-3-5-8-12)11-14-13-9-6-10-15(13)17-16-14/h3-5,7-8,13-14,17H,6,9-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | WLRFEJWCDCNZBN-UONOGXRCSA-N |
| XLogP | 2.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|