C23H17FN4O3 — CID 165089637
2-amino-5-[[6-fluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]benzoic acid (PubChem CID 165089637) has the molecular formula C23H17FN4O3 and a molecular weight of 416.41 g/mol. Its IUPAC name is 2-amino-5-[[6-fluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]benzoic acid.
| Compound Name | 2-amino-5-[[6-fluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 165089637 |
| Molecular Formula | C23H17FN4O3 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 2-amino-5-[[6-fluoro-5-(1-methylindol-5-yl)-1H-benzimidazol-2-yl]oxy]benzoic acid |
| SMILES | Cn1ccc2cc(-c3cc4nc(Oc5ccc(N)c(C(=O)O)c5)[nH]c4cc3F)ccc21 |
| InChI | InChI=1S/C23H17FN4O3/c1-28-7-6-13-8-12(2-5-21(13)28)15-10-19-20(11-17(15)24)27-23(26-19)31-14-3-4-18(25)16(9-14)22(29)30/h2-11H,25H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | WMEOEEPYXGAQMX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|