C19H17Cl3N2O3 — CID 16509040
[1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] 3,4,5-trichloropyridine-2-carboxylate (PubChem CID 16509040) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] 3,4,5-trichloropyridine-2-carboxylate.
| Compound Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 16509040 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | [1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl] 3,4,5-trichloropyridine-2-carboxylate |
| SMILES | CC(OC(=O)c1ncc(Cl)c(Cl)c1Cl)C(=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H17Cl3N2O3/c1-10(27-19(26)17-16(22)15(21)13(20)9-23-17)18(25)24-14-8-4-6-11-5-2-3-7-12(11)14/h2-3,5,7,9-10,14H,4,6,8H2,1H3,(H,24,25) |
| InChIKey | UEWDDXCBQCCPTK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |