C21H22Cl2O — CID 165093425
3-chloro-1-[(1R)-6-chloro-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 165093425) has the molecular formula C21H22Cl2O and a molecular weight of 361.31 g/mol. Its IUPAC name is 3-chloro-1-[(1R)-6-chloro-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 3-chloro-1-[(1R)-6-chloro-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 165093425 |
| Molecular Formula | C21H22Cl2O |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 3-chloro-1-[(1R)-6-chloro-7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Cc1cc2c(cc1Cl)CCC[C@H]2c1c(O)c(Cl)cc2c1CCCC2 |
| InChI | InChI=1S/C21H22Cl2O/c1-12-9-17-14(10-18(12)22)6-4-8-16(17)20-15-7-3-2-5-13(15)11-19(23)21(20)24/h9-11,16,24H,2-8H2,1H3/t16-/m1/s1 |
| InChIKey | GIOIFEWFCNXNDA-MRXNPFEDSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |