C20H14BrF13O — CID 165094755
(2Z)-2-(8-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorooctylidene)-4-phenylcyclohexan-1-one (PubChem CID 165094755) has the molecular formula C20H14BrF13O and a molecular weight of 597.21 g/mol. Its IUPAC name is (2Z)-2-(8-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorooctylidene)-4-phenylcyclohexan-1-one.
| Compound Name | (2Z)-2-(8-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorooctylidene)-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 165094755 |
| Molecular Formula | C20H14BrF13O |
| Molecular Weight | 597.21 g/mol |
| Exact Mass | 596.00 |
| IUPAC Name | (2Z)-2-(8-bromo-1,2,2,3,3,4,4,5,5,6,6,7,7-tridecafluorooctylidene)-4-phenylcyclohexan-1-one |
| SMILES | O=C1CCC(c2ccccc2)C/C1=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CBr |
| InChI | InChI=1S/C20H14BrF13O/c21-9-15(23,24)17(27,28)19(31,32)20(33,34)18(29,30)16(25,26)14(22)12-8-11(6-7-13(12)35)10-4-2-1-3-5-10/h1-5,11H,6-9H2/b14-12- |
| InChIKey | XHPRFJFRNGFFHM-OWBHPGMISA-N |
| XLogP | 7.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.21 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|