About CID 165094907
CID 165094907 (PubChem CID 165094907) has the molecular formula C6H7ClOS3
and a molecular weight of 226.78 g/mol.
Molecular Properties
| Compound Name | CID 165094907 |
| PubChem CID | 165094907 |
| Molecular Formula | C6H7ClOS3 |
| Molecular Weight | 226.78 g/mol |
| Exact Mass | 225.93 |
| IUPAC Name | — |
| SMILES | OCCc1csc(Cl)c1.S=S |
| InChI | InChI=1S/C6H7ClOS.S2/c7-6-3-5(1-2-8)4-9-6;1-2/h3-4,8H,1-2H2; |
| InChIKey | XIFNXWCEBASLNA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.78 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 165094907 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 165094907?
The IUPAC name of CID 165094907 (CID 165094907) is not available.
What is the SMILES notation for CID 165094907?
The canonical SMILES for CID 165094907 is OCCc1csc(Cl)c1.S=S.
What is the InChIKey of CID 165094907?
The InChIKey is XIFNXWCEBASLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClOS.S2/c7-6-3-5(1-2-8)4-9-6;1-2/h3-4,8H,1-2H2;.
What are the key properties of CID 165094907?
CID 165094907 has a molecular weight of 226.78 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 165094907 is sourced from PubChem (CID 165094907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).