About 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate
2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate (PubChem CID 165095154) has the molecular formula C14H17ClN4O2
and a molecular weight of 308.77 g/mol. Its IUPAC name is 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate |
| PubChem CID | 165095154 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate |
| SMILES | COC(=O)c1nccc(N)c1C.Cc1c(N)ccnc1Cl |
| InChI | InChI=1S/C8H10N2O2.C6H7ClN2/c1-5-6(9)3-4-10-7(5)8(11)12-2;1-4-5(8)2-3-9-6(4)7/h3-4H,1-2H3,(H2,9,10);2-3H,1H3,(H2,8,9) |
| InChIKey | XJKMNUKQMHFNEC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate?
The IUPAC name of 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate (CID 165095154) is 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate.
What is the SMILES notation for 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate?
The canonical SMILES for 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate is COC(=O)c1nccc(N)c1C.Cc1c(N)ccnc1Cl.
What is the InChIKey of 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate?
The InChIKey is XJKMNUKQMHFNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.C6H7ClN2/c1-5-6(9)3-4-10-7(5)8(11)12-2;1-4-5(8)2-3-9-6(4)7/h3-4H,1-2H3,(H2,9,10);2-3H,1H3,(H2,8,9).
What are the key properties of 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate?
2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate has a molecular weight of 308.77 g/mol, XLogP of 2.38, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methylpyridin-4-amine;methyl 4-amino-3-methylpyridine-2-carboxylate is sourced from PubChem (CID 165095154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).