C19H19F4N3O3 — CID 165097730
5-[2-(4-fluoro-3-methylphenyl)acetyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 165097730) has the molecular formula C19H19F4N3O3 and a molecular weight of 413.37 g/mol. Its IUPAC name is 5-[2-(4-fluoro-3-methylphenyl)acetyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-[2-(4-fluoro-3-methylphenyl)acetyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165097730 |
| Molecular Formula | C19H19F4N3O3 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 5-[2-(4-fluoro-3-methylphenyl)acetyl]-N-[(2R)-1,1,1-trifluoropropan-2-yl]-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | Cc1cc(CC(=O)N2CCc3noc(C(=O)N[C@H](C)C(F)(F)F)c3C2)ccc1F |
| InChI | InChI=1S/C19H19F4N3O3/c1-10-7-12(3-4-14(10)20)8-16(27)26-6-5-15-13(9-26)17(29-25-15)18(28)24-11(2)19(21,22)23/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,24,28)/t11-/m1/s1 |
| InChIKey | XUGOCUFETLFCMP-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |