C17H34O6Si — CID 165098217
[1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-(2-prop-2-enoxyethoxy)propan-2-yl]oxy-trimethylsilane (PubChem CID 165098217) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is [1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-(2-prop-2-enoxyethoxy)propan-2-yl]oxy-trimethylsilane.
| Compound Name | [1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-(2-prop-2-enoxyethoxy)propan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 165098217 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-(2-prop-2-enoxyethoxy)propan-2-yl]oxy-trimethylsilane |
| SMILES | C=CCOCCOCC(COCC1COC(C)(C)O1)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O6Si/c1-7-8-18-9-10-19-12-16(23-24(4,5)6)13-20-11-15-14-21-17(2,3)22-15/h7,15-16H,1,8-14H2,2-6H3 |
| InChIKey | XWIWCPPSLVQCOY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|