C30H53ClN4O10Si2 — CID 165098881
2-(chloromethoxy)ethyl-trimethylsilane;diethyl 1H-pyrazole-3,5-dicarboxylate;diethyl 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarboxylate (PubChem CID 165098881) has the molecular formula C30H53ClN4O10Si2 and a molecular weight of 721.40 g/mol. Its IUPAC name is 2-(chloromethoxy)ethyl-trimethylsilane;diethyl 1H-pyrazole-3,5-dicarboxylate;diethyl 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarboxylate.
| Compound Name | 2-(chloromethoxy)ethyl-trimethylsilane;diethyl 1H-pyrazole-3,5-dicarboxylate;diethyl 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 165098881 |
| Molecular Formula | C30H53ClN4O10Si2 |
| Molecular Weight | 721.40 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | 2-(chloromethoxy)ethyl-trimethylsilane;diethyl 1H-pyrazole-3,5-dicarboxylate;diethyl 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)[nH]n1.CCOC(=O)c1cc(C(=O)OCC)n(COCC[Si](C)(C)C)n1.C[Si](C)(C)CCOCCl |
| InChI | InChI=1S/C15H26N2O5Si.C9H12N2O4.C6H15ClOSi/c1-6-21-14(18)12-10-13(15(19)22-7-2)17(16-12)11-20-8-9-23(3,4)5;1-3-14-8(12)6-5-7(11-10-6)9(13)15-4-2;1-9(2,3)5-4-8-6-7/h10H,6-9,11H2,1-5H3;5H,3-4H2,1-2H3,(H,10,11);4-6H2,1-3H3 |
| InChIKey | XZHAWCPHOSRVLJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|