About ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate
ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate (PubChem CID 165099680) has the molecular formula C20H32O9
and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate |
| PubChem CID | 165099680 |
| Molecular Formula | C20H32O9 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate |
| SMILES | CCOC(=O)CC1CC(=O)CCO1.CCOC(=O)CC1CC2(CCO1)OCCO2 |
| InChI | InChI=1S/C11H18O5.C9H14O4/c1-2-13-10(12)7-9-8-11(3-4-14-9)15-5-6-16-11;1-2-12-9(11)6-8-5-7(10)3-4-13-8/h9H,2-8H2,1H3;8H,2-6H2,1H3 |
| InChIKey | YCOFNLIHCLCCBI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate?
The IUPAC name of ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate (CID 165099680) is ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate.
What is the SMILES notation for ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate?
The canonical SMILES for ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate is CCOC(=O)CC1CC(=O)CCO1.CCOC(=O)CC1CC2(CCO1)OCCO2.
What is the InChIKey of ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate?
The InChIKey is YCOFNLIHCLCCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5.C9H14O4/c1-2-13-10(12)7-9-8-11(3-4-14-9)15-5-6-16-11;1-2-12-9(11)6-8-5-7(10)3-4-13-8/h9H,2-8H2,1H3;8H,2-6H2,1H3.
What are the key properties of ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate?
ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate has a molecular weight of 416.47 g/mol, XLogP of 1.55, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-oxooxan-2-yl)acetate;ethyl 2-(1,4,8-trioxaspiro[4.5]decan-7-yl)acetate is sourced from PubChem (CID 165099680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).