C34H41B2IN2O6 — CID 165101763
3-iodopyridine;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine (PubChem CID 165101763) has the molecular formula C34H41B2IN2O6 and a molecular weight of 722.24 g/mol. Its IUPAC name is 3-iodopyridine;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine.
| Compound Name | 3-iodopyridine;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine |
|---|---|
| PubChem CID | 165101763 |
| Molecular Formula | C34H41B2IN2O6 |
| Molecular Weight | 722.24 g/mol |
| Exact Mass | 722.22 |
| IUPAC Name | 3-iodopyridine;3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyridine |
| SMILES | CC1(C)OB(c2cccc(O)c2)OC1(C)C.CC1(C)OB(c2cccc(Oc3cccnc3)c2)OC1(C)C.Ic1cccnc1 |
| InChI | InChI=1S/C17H20BNO3.C12H17BO3.C5H4IN/c1-16(2)17(3,4)22-18(21-16)13-7-5-8-14(11-13)20-15-9-6-10-19-12-15;1-11(2)12(3,4)16-13(15-11)9-6-5-7-10(14)8-9;6-5-2-1-3-7-4-5/h5-12H,1-4H3;5-8,14H,1-4H3;1-4H |
| InChIKey | YLIKQLRITAGSCU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.24 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|